About 2-methylsulfanyl-7-[3-(trifluoromethoxy)phenoxy]-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile
2-methylsulfanyl-7-[3-(trifluoromethoxy)phenoxy]-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile (PubChem CID 58612240) has the molecular formula C15H8F3N3O2S2
and a molecular weight of 383.38 g/mol. Its IUPAC name is 2-methylsulfanyl-7-[3-(trifluoromethoxy)phenoxy]-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile.
Molecular Properties
| Compound Name | 2-methylsulfanyl-7-[3-(trifluoromethoxy)phenoxy]-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile |
| PubChem CID | 58612240 |
| Molecular Formula | C15H8F3N3O2S2 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | 2-methylsulfanyl-7-[3-(trifluoromethoxy)phenoxy]-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile |
| SMILES | CSc1nc2ncc(C#N)c(Oc3cccc(OC(F)(F)F)c3)c2s1 |
| InChI | InChI=1S/C15H8F3N3O2S2/c1-24-14-21-13-12(25-14)11(8(6-19)7-20-13)22-9-3-2-4-10(5-9)23-15(16,17)18/h2-5,7H,1H3 |
| InChIKey | UGPLGASNYVHKNM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 68.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-methylsulfanyl-7-[3-(trifluoromethoxy)phenoxy]-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-7-[3-(trifluoromethoxy)phenoxy]-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile?
The IUPAC name of 2-methylsulfanyl-7-[3-(trifluoromethoxy)phenoxy]-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile (CID 58612240) is 2-methylsulfanyl-7-[3-(trifluoromethoxy)phenoxy]-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile.
What is the SMILES notation for 2-methylsulfanyl-7-[3-(trifluoromethoxy)phenoxy]-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile?
The canonical SMILES for 2-methylsulfanyl-7-[3-(trifluoromethoxy)phenoxy]-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile is CSc1nc2ncc(C#N)c(Oc3cccc(OC(F)(F)F)c3)c2s1.
What is the InChIKey of 2-methylsulfanyl-7-[3-(trifluoromethoxy)phenoxy]-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile?
The InChIKey is UGPLGASNYVHKNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8F3N3O2S2/c1-24-14-21-13-12(25-14)11(8(6-19)7-20-13)22-9-3-2-4-10(5-9)23-15(16,17)18/h2-5,7H,1H3.
What are the key properties of 2-methylsulfanyl-7-[3-(trifluoromethoxy)phenoxy]-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile?
2-methylsulfanyl-7-[3-(trifluoromethoxy)phenoxy]-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile has a molecular weight of 383.38 g/mol, XLogP of 4.98, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-7-[3-(trifluoromethoxy)phenoxy]-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile is sourced from PubChem (CID 58612240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).