About [(6R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-6-yl] 9-hydroxyfluorene-9-carboxylate
[(6R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-6-yl] 9-hydroxyfluorene-9-carboxylate (PubChem CID 58612268) has the molecular formula C23H26NO3+
and a molecular weight of 364.46 g/mol. Its IUPAC name is [(6R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-6-yl] 9-hydroxyfluorene-9-carboxylate.
Molecular Properties
| Compound Name | [(6R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-6-yl] 9-hydroxyfluorene-9-carboxylate |
| PubChem CID | 58612268 |
| Molecular Formula | C23H26NO3+ |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | [(6R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-6-yl] 9-hydroxyfluorene-9-carboxylate |
| SMILES | C[N+]1(C)C2CCCC1[C@H](OC(=O)C1(O)c3ccccc3-c3ccccc31)C2 |
| InChI | InChI=1S/C23H26NO3/c1-24(2)15-8-7-13-20(24)21(14-15)27-22(25)23(26)18-11-5-3-9-16(18)17-10-4-6-12-19(17)23/h3-6,9-12,15,20-21,26H,7-8,13-14H2,1-2H3/q+1/t15?,20?,21-/m1/s1 |
| InChIKey | CWWHJTAJPJETHZ-KUTOWUBSSA-N |
| XLogP | 3.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(6R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-6-yl] 9-hydroxyfluorene-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-6-yl] 9-hydroxyfluorene-9-carboxylate?
The IUPAC name of [(6R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-6-yl] 9-hydroxyfluorene-9-carboxylate (CID 58612268) is [(6R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-6-yl] 9-hydroxyfluorene-9-carboxylate.
What is the SMILES notation for [(6R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-6-yl] 9-hydroxyfluorene-9-carboxylate?
The canonical SMILES for [(6R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-6-yl] 9-hydroxyfluorene-9-carboxylate is C[N+]1(C)C2CCCC1[C@H](OC(=O)C1(O)c3ccccc3-c3ccccc31)C2.
What is the InChIKey of [(6R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-6-yl] 9-hydroxyfluorene-9-carboxylate?
The InChIKey is CWWHJTAJPJETHZ-KUTOWUBSSA-N. The full InChI is InChI=1S/C23H26NO3/c1-24(2)15-8-7-13-20(24)21(14-15)27-22(25)23(26)18-11-5-3-9-16(18)17-10-4-6-12-19(17)23/h3-6,9-12,15,20-21,26H,7-8,13-14H2,1-2H3/q+1/t15?,20?,21-/m1/s1.
What are the key properties of [(6R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-6-yl] 9-hydroxyfluorene-9-carboxylate?
[(6R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-6-yl] 9-hydroxyfluorene-9-carboxylate has a molecular weight of 364.46 g/mol, XLogP of 3.22, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(6R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-6-yl] 9-hydroxyfluorene-9-carboxylate is sourced from PubChem (CID 58612268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).