About 2,3-dimethoxypropyl N-ethylcarbamate
2,3-dimethoxypropyl N-ethylcarbamate (PubChem CID 58612429) has the molecular formula C8H17NO4
and a molecular weight of 191.23 g/mol. Its IUPAC name is 2,3-dimethoxypropyl N-ethylcarbamate.
Molecular Properties
| Compound Name | 2,3-dimethoxypropyl N-ethylcarbamate |
| PubChem CID | 58612429 |
| Molecular Formula | C8H17NO4 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 2,3-dimethoxypropyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCC(COC)OC |
| InChI | InChI=1S/C8H17NO4/c1-4-9-8(10)13-6-7(12-3)5-11-2/h7H,4-6H2,1-3H3,(H,9,10) |
| InChIKey | HIRRXDOXUWBHQH-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dimethoxypropyl N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethoxypropyl N-ethylcarbamate?
The IUPAC name of 2,3-dimethoxypropyl N-ethylcarbamate (CID 58612429) is 2,3-dimethoxypropyl N-ethylcarbamate.
What is the SMILES notation for 2,3-dimethoxypropyl N-ethylcarbamate?
The canonical SMILES for 2,3-dimethoxypropyl N-ethylcarbamate is CCNC(=O)OCC(COC)OC.
What is the InChIKey of 2,3-dimethoxypropyl N-ethylcarbamate?
The InChIKey is HIRRXDOXUWBHQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO4/c1-4-9-8(10)13-6-7(12-3)5-11-2/h7H,4-6H2,1-3H3,(H,9,10).
What are the key properties of 2,3-dimethoxypropyl N-ethylcarbamate?
2,3-dimethoxypropyl N-ethylcarbamate has a molecular weight of 191.23 g/mol, XLogP of 0.39, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethoxypropyl N-ethylcarbamate is sourced from PubChem (CID 58612429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).