C28H49B — CID 58612499
(3E,6E,14E,17E)-1-(2,3-dimethylbutan-2-yl)-3,6,15,18-tetramethyl-1-boracyclononadeca-3,6,14,17-tetraene (PubChem CID 58612499) has the molecular formula C28H49B and a molecular weight of 396.51 g/mol. Its IUPAC name is (3E,6E,14E,17E)-1-(2,3-dimethylbutan-2-yl)-3,6,15,18-tetramethyl-1-boracyclononadeca-3,6,14,17-tetraene.
| Compound Name | (3E,6E,14E,17E)-1-(2,3-dimethylbutan-2-yl)-3,6,15,18-tetramethyl-1-boracyclononadeca-3,6,14,17-tetraene |
|---|---|
| PubChem CID | 58612499 |
| Molecular Formula | C28H49B |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.39 |
| IUPAC Name | (3E,6E,14E,17E)-1-(2,3-dimethylbutan-2-yl)-3,6,15,18-tetramethyl-1-boracyclononadeca-3,6,14,17-tetraene |
| SMILES | C/C1=C\CCCCCC/C=C(\C)C/C=C(\C)CB(C(C)(C)C(C)C)C/C(C)=C/C1 |
| InChI | InChI=1S/C28H49B/c1-23(2)28(7,8)29-21-26(5)19-17-24(3)15-13-11-9-10-12-14-16-25(4)18-20-27(6)22-29/h15-16,19-20,23H,9-14,17-18,21-22H2,1-8H3/b24-15+,25-16+,26-19+,27-20+ |
| InChIKey | OFHXOFBYEMOBRH-AXBIGJGMSA-N |
| XLogP | 9.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|