C20H37B — CID 58612501
(3E,11E)-1-(2,3-dimethylbutan-2-yl)-3,12-dimethyl-1-boracyclotrideca-3,11-diene (PubChem CID 58612501) has the molecular formula C20H37B and a molecular weight of 288.33 g/mol. Its IUPAC name is (3E,11E)-1-(2,3-dimethylbutan-2-yl)-3,12-dimethyl-1-boracyclotrideca-3,11-diene.
| Compound Name | (3E,11E)-1-(2,3-dimethylbutan-2-yl)-3,12-dimethyl-1-boracyclotrideca-3,11-diene |
|---|---|
| PubChem CID | 58612501 |
| Molecular Formula | C20H37B |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.30 |
| IUPAC Name | (3E,11E)-1-(2,3-dimethylbutan-2-yl)-3,12-dimethyl-1-boracyclotrideca-3,11-diene |
| SMILES | C/C1=C\CCCCCC/C=C(\C)CB(C(C)(C)C(C)C)C1 |
| InChI | InChI=1S/C20H37B/c1-17(2)20(5,6)21-15-18(3)13-11-9-7-8-10-12-14-19(4)16-21/h13-14,17H,7-12,15-16H2,1-6H3/b18-13+,19-14+ |
| InChIKey | LJFBDUHKFREZTK-JIBZRZDWSA-N |
| XLogP | 7.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|