About [4-[(E,3E)-3-(diphenylhydrazinylidene)-1-(4-methoxyphenyl)prop-1-enyl]phenyl]methanol
[4-[(E,3E)-3-(diphenylhydrazinylidene)-1-(4-methoxyphenyl)prop-1-enyl]phenyl]methanol (PubChem CID 58612806) has the molecular formula C29H26N2O2
and a molecular weight of 434.54 g/mol. Its IUPAC name is [4-[(E,3E)-3-(diphenylhydrazinylidene)-1-(4-methoxyphenyl)prop-1-enyl]phenyl]methanol.
Molecular Properties
| Compound Name | [4-[(E,3E)-3-(diphenylhydrazinylidene)-1-(4-methoxyphenyl)prop-1-enyl]phenyl]methanol |
| PubChem CID | 58612806 |
| Molecular Formula | C29H26N2O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | [4-[(E,3E)-3-(diphenylhydrazinylidene)-1-(4-methoxyphenyl)prop-1-enyl]phenyl]methanol |
| SMILES | COc1ccc(/C(=C/C=N/N(c2ccccc2)c2ccccc2)c2ccc(CO)cc2)cc1 |
| InChI | InChI=1S/C29H26N2O2/c1-33-28-18-16-25(17-19-28)29(24-14-12-23(22-32)13-15-24)20-21-30-31(26-8-4-2-5-9-26)27-10-6-3-7-11-27/h2-21,32H,22H2,1H3/b29-20+,30-21+ |
| InChIKey | RSDOHBKUVBHLNY-RZEGEWEPSA-N |
| XLogP | 6.44 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[(E,3E)-3-(diphenylhydrazinylidene)-1-(4-methoxyphenyl)prop-1-enyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(E,3E)-3-(diphenylhydrazinylidene)-1-(4-methoxyphenyl)prop-1-enyl]phenyl]methanol?
The IUPAC name of [4-[(E,3E)-3-(diphenylhydrazinylidene)-1-(4-methoxyphenyl)prop-1-enyl]phenyl]methanol (CID 58612806) is [4-[(E,3E)-3-(diphenylhydrazinylidene)-1-(4-methoxyphenyl)prop-1-enyl]phenyl]methanol.
What is the SMILES notation for [4-[(E,3E)-3-(diphenylhydrazinylidene)-1-(4-methoxyphenyl)prop-1-enyl]phenyl]methanol?
The canonical SMILES for [4-[(E,3E)-3-(diphenylhydrazinylidene)-1-(4-methoxyphenyl)prop-1-enyl]phenyl]methanol is COc1ccc(/C(=C/C=N/N(c2ccccc2)c2ccccc2)c2ccc(CO)cc2)cc1.
What is the InChIKey of [4-[(E,3E)-3-(diphenylhydrazinylidene)-1-(4-methoxyphenyl)prop-1-enyl]phenyl]methanol?
The InChIKey is RSDOHBKUVBHLNY-RZEGEWEPSA-N. The full InChI is InChI=1S/C29H26N2O2/c1-33-28-18-16-25(17-19-28)29(24-14-12-23(22-32)13-15-24)20-21-30-31(26-8-4-2-5-9-26)27-10-6-3-7-11-27/h2-21,32H,22H2,1H3/b29-20+,30-21+.
What are the key properties of [4-[(E,3E)-3-(diphenylhydrazinylidene)-1-(4-methoxyphenyl)prop-1-enyl]phenyl]methanol?
[4-[(E,3E)-3-(diphenylhydrazinylidene)-1-(4-methoxyphenyl)prop-1-enyl]phenyl]methanol has a molecular weight of 434.54 g/mol, XLogP of 6.44, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(E,3E)-3-(diphenylhydrazinylidene)-1-(4-methoxyphenyl)prop-1-enyl]phenyl]methanol is sourced from PubChem (CID 58612806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).