C26H26I6NO12P — CID 58612864
[(2R)-2,3-bis[[2-(3,4,5-triiodobenzoyl)oxyacetyl]oxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 58612864) has the molecular formula C26H26I6NO12P and a molecular weight of 1336.89 g/mol. Its IUPAC name is [(2R)-2,3-bis[[2-(3,4,5-triiodobenzoyl)oxyacetyl]oxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-2,3-bis[[2-(3,4,5-triiodobenzoyl)oxyacetyl]oxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 58612864 |
| Molecular Formula | C26H26I6NO12P |
| Molecular Weight | 1336.89 g/mol |
| Exact Mass | 1336.55 |
| IUPAC Name | [(2R)-2,3-bis[[2-(3,4,5-triiodobenzoyl)oxyacetyl]oxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])OC[C@@H](COC(=O)COC(=O)c1cc(I)c(I)c(I)c1)OC(=O)COC(=O)c1cc(I)c(I)c(I)c1 |
| InChI | InChI=1S/C26H26I6NO12P/c1-33(2,3)4-5-43-46(38,39)44-11-16(45-22(35)13-42-26(37)15-8-19(29)24(32)20(30)9-15)10-40-21(34)12-41-25(36)14-6-17(27)23(31)18(28)7-14/h6-9,16H,4-5,10-13H2,1-3H3/t16-/m1/s1 |
| InChIKey | ZFYJFQKTTPUCSH-MRXNPFEDSA-N |
| XLogP | 4.99 |
| TPSA | 163.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1336.89 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|