C24H17F2NO6 — CID 58613135
2,3,4,5-tetradeuterio-6-[2,7-difluoro-3-hydroxy-6-oxo-4-[(propanoylamino)methyl]xanthen-9-yl]benzoic acid (PubChem CID 58613135) has the molecular formula C24H17F2NO6 and a molecular weight of 457.42 g/mol. Its IUPAC name is 2,3,4,5-tetradeuterio-6-[2,7-difluoro-3-hydroxy-6-oxo-4-[(propanoylamino)methyl]xanthen-9-yl]benzoic acid.
| Compound Name | 2,3,4,5-tetradeuterio-6-[2,7-difluoro-3-hydroxy-6-oxo-4-[(propanoylamino)methyl]xanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 58613135 |
| Molecular Formula | C24H17F2NO6 |
| Molecular Weight | 457.42 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 2,3,4,5-tetradeuterio-6-[2,7-difluoro-3-hydroxy-6-oxo-4-[(propanoylamino)methyl]xanthen-9-yl]benzoic acid |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3cc(F)c(=O)cc-3oc3c(CNC(=O)CC)c(O)c(F)cc23)c(C(=O)O)c1[2H] |
| InChI | InChI=1S/C24H17F2NO6/c1-2-20(29)27-10-15-22(30)17(26)8-14-21(11-5-3-4-6-12(11)24(31)32)13-7-16(25)18(28)9-19(13)33-23(14)15/h3-9,30H,2,10H2,1H3,(H,27,29)(H,31,32)/i3D,4D,5D,6D |
| InChIKey | GGXLBLBFPSFCMN-LNFUJOGGSA-N |
| XLogP | 4.27 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|