C16H23NO2 — CID 58613157
(4aR,10bR)-9-[(2-methylpropan-2-yl)oxy]-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,4]benzoxazine (PubChem CID 58613157) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is (4aR,10bR)-9-[(2-methylpropan-2-yl)oxy]-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,4]benzoxazine.
| Compound Name | (4aR,10bR)-9-[(2-methylpropan-2-yl)oxy]-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,4]benzoxazine |
|---|---|
| PubChem CID | 58613157 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (4aR,10bR)-9-[(2-methylpropan-2-yl)oxy]-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,4]benzoxazine |
| SMILES | CC(C)(C)Oc1ccc2c(c1)[C@H]1OCCN[C@@H]1CC2 |
| InChI | InChI=1S/C16H23NO2/c1-16(2,3)19-12-6-4-11-5-7-14-15(13(11)10-12)18-9-8-17-14/h4,6,10,14-15,17H,5,7-9H2,1-3H3/t14-,15-/m1/s1 |
| InChIKey | CXKUXEUHOODQAV-HUUCEWRRSA-N |
| XLogP | 2.84 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |