C28H29FN4O2 — CID 58613594
(E)-3-[1-[2-(6-fluoro-1H-indol-3-yl)ethyl-[(2-methyl-1H-pyrrol-3-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 58613594) has the molecular formula C28H29FN4O2 and a molecular weight of 472.56 g/mol. Its IUPAC name is (E)-3-[1-[2-(6-fluoro-1H-indol-3-yl)ethyl-[(2-methyl-1H-pyrrol-3-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[1-[2-(6-fluoro-1H-indol-3-yl)ethyl-[(2-methyl-1H-pyrrol-3-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 58613594 |
| Molecular Formula | C28H29FN4O2 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | (E)-3-[1-[2-(6-fluoro-1H-indol-3-yl)ethyl-[(2-methyl-1H-pyrrol-3-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | Cc1[nH]ccc1CN(CCc1c[nH]c2cc(F)ccc12)C1CCc2cc(/C=C/C(=O)NO)ccc21 |
| InChI | InChI=1S/C28H29FN4O2/c1-18-22(10-12-30-18)17-33(13-11-21-16-31-26-15-23(29)5-7-24(21)26)27-8-4-20-14-19(2-6-25(20)27)3-9-28(34)32-35/h2-3,5-7,9-10,12,14-16,27,30-31,35H,4,8,11,13,17H2,1H3,(H,32,34)/b9-3+ |
| InChIKey | DJCZCNVOPFKCGV-YCRREMRBSA-N |
| XLogP | 5.19 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|