C23H26FNO3 — CID 58613618
methyl (E)-3-[1-[2-(4-fluorophenyl)ethyl-(2-hydroxyethyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate (PubChem CID 58613618) has the molecular formula C23H26FNO3 and a molecular weight of 383.46 g/mol. Its IUPAC name is methyl (E)-3-[1-[2-(4-fluorophenyl)ethyl-(2-hydroxyethyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[1-[2-(4-fluorophenyl)ethyl-(2-hydroxyethyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 58613618 |
| Molecular Formula | C23H26FNO3 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | methyl (E)-3-[1-[2-(4-fluorophenyl)ethyl-(2-hydroxyethyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc2c(c1)CCC2N(CCO)CCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H26FNO3/c1-28-23(27)11-5-18-4-9-21-19(16-18)6-10-22(21)25(14-15-26)13-12-17-2-7-20(24)8-3-17/h2-5,7-9,11,16,22,26H,6,10,12-15H2,1H3/b11-5+ |
| InChIKey | IFZKIULFBTWTBL-VZUCSPMQSA-N |
| XLogP | 3.54 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|