C29H30ClFN4O2 — CID 58613664
(E)-3-[1-[2-(6-chloro-1H-indol-3-yl)ethyl-[(4-fluoro-3,5-dimethyl-1H-pyrrol-2-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 58613664) has the molecular formula C29H30ClFN4O2 and a molecular weight of 521.04 g/mol. Its IUPAC name is (E)-3-[1-[2-(6-chloro-1H-indol-3-yl)ethyl-[(4-fluoro-3,5-dimethyl-1H-pyrrol-2-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[1-[2-(6-chloro-1H-indol-3-yl)ethyl-[(4-fluoro-3,5-dimethyl-1H-pyrrol-2-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 58613664 |
| Molecular Formula | C29H30ClFN4O2 |
| Molecular Weight | 521.04 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | (E)-3-[1-[2-(6-chloro-1H-indol-3-yl)ethyl-[(4-fluoro-3,5-dimethyl-1H-pyrrol-2-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | Cc1[nH]c(CN(CCc2c[nH]c3cc(Cl)ccc23)C2CCc3cc(/C=C/C(=O)NO)ccc32)c(C)c1F |
| InChI | InChI=1S/C29H30ClFN4O2/c1-17-26(33-18(2)29(17)31)16-35(12-11-21-15-32-25-14-22(30)6-8-23(21)25)27-9-5-20-13-19(3-7-24(20)27)4-10-28(36)34-37/h3-4,6-8,10,13-15,27,32-33,37H,5,9,11-12,16H2,1-2H3,(H,34,36)/b10-4+ |
| InChIKey | PWCFMRBWSSXKRU-ONNFQVAWSA-N |
| XLogP | 6.16 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.04 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|