C28H30FN5O2 — CID 58613668
(E)-3-[1-[(1,5-dimethylpyrazol-4-yl)methyl-[2-(6-fluoro-1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 58613668) has the molecular formula C28H30FN5O2 and a molecular weight of 487.58 g/mol. Its IUPAC name is (E)-3-[1-[(1,5-dimethylpyrazol-4-yl)methyl-[2-(6-fluoro-1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[1-[(1,5-dimethylpyrazol-4-yl)methyl-[2-(6-fluoro-1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 58613668 |
| Molecular Formula | C28H30FN5O2 |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | (E)-3-[1-[(1,5-dimethylpyrazol-4-yl)methyl-[2-(6-fluoro-1H-indol-3-yl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | Cc1c(CN(CCc2c[nH]c3cc(F)ccc23)C2CCc3cc(/C=C/C(=O)NO)ccc32)cnn1C |
| InChI | InChI=1S/C28H30FN5O2/c1-18-22(16-31-33(18)2)17-34(12-11-21-15-30-26-14-23(29)6-8-24(21)26)27-9-5-20-13-19(3-7-25(20)27)4-10-28(35)32-36/h3-4,6-8,10,13-16,27,30,36H,5,9,11-12,17H2,1-2H3,(H,32,35)/b10-4+ |
| InChIKey | UYQMKXPKXIHHRX-ONNFQVAWSA-N |
| XLogP | 4.60 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|