C27H28FN5O2 — CID 58613699
(E)-3-[1-[2-(6-fluoro-1H-indol-3-yl)ethyl-[(5-methyl-1H-pyrazol-4-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 58613699) has the molecular formula C27H28FN5O2 and a molecular weight of 473.55 g/mol. Its IUPAC name is (E)-3-[1-[2-(6-fluoro-1H-indol-3-yl)ethyl-[(5-methyl-1H-pyrazol-4-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[1-[2-(6-fluoro-1H-indol-3-yl)ethyl-[(5-methyl-1H-pyrazol-4-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 58613699 |
| Molecular Formula | C27H28FN5O2 |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | (E)-3-[1-[2-(6-fluoro-1H-indol-3-yl)ethyl-[(5-methyl-1H-pyrazol-4-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | Cc1[nH]ncc1CN(CCc1c[nH]c2cc(F)ccc12)C1CCc2cc(/C=C/C(=O)NO)ccc21 |
| InChI | InChI=1S/C27H28FN5O2/c1-17-21(15-30-31-17)16-33(11-10-20-14-29-25-13-22(28)5-7-23(20)25)26-8-4-19-12-18(2-6-24(19)26)3-9-27(34)32-35/h2-3,5-7,9,12-15,26,29,35H,4,8,10-11,16H2,1H3,(H,30,31)(H,32,34)/b9-3+ |
| InChIKey | LIMVEFLSCSZYDH-YCRREMRBSA-N |
| XLogP | 4.59 |
| TPSA | 97.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|