C30H40F3NO3Si — CID 58613937
methyl (E)-3-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[2-[4-(trifluoromethyl)phenyl]ethyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate (PubChem CID 58613937) has the molecular formula C30H40F3NO3Si and a molecular weight of 547.73 g/mol. Its IUPAC name is methyl (E)-3-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[2-[4-(trifluoromethyl)phenyl]ethyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[2-[4-(trifluoromethyl)phenyl]ethyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 58613937 |
| Molecular Formula | C30H40F3NO3Si |
| Molecular Weight | 547.73 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | methyl (E)-3-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[2-[4-(trifluoromethyl)phenyl]ethyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc2c(c1)CCC2N(CCO[Si](C)(C)C(C)(C)C)CCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H40F3NO3Si/c1-29(2,3)38(5,6)37-20-19-34(18-17-22-7-12-25(13-8-22)30(31,32)33)27-15-11-24-21-23(9-14-26(24)27)10-16-28(35)36-4/h7-10,12-14,16,21,27H,11,15,17-20H2,1-6H3/b16-10+ |
| InChIKey | JVMLFSNQZBFDLI-MHWRWJLKSA-N |
| XLogP | 7.45 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.73 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|