C20H22N2O2 — CID 58613989
methyl (E)-3-[1-(2-pyridin-4-ylethylamino)-2,3-dihydro-1H-inden-5-yl]prop-2-enoate (PubChem CID 58613989) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is methyl (E)-3-[1-(2-pyridin-4-ylethylamino)-2,3-dihydro-1H-inden-5-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[1-(2-pyridin-4-ylethylamino)-2,3-dihydro-1H-inden-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 58613989 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | methyl (E)-3-[1-(2-pyridin-4-ylethylamino)-2,3-dihydro-1H-inden-5-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc2c(c1)CCC2NCCc1ccncc1 |
| InChI | InChI=1S/C20H22N2O2/c1-24-20(23)7-3-16-2-5-18-17(14-16)4-6-19(18)22-13-10-15-8-11-21-12-9-15/h2-3,5,7-9,11-12,14,19,22H,4,6,10,13H2,1H3/b7-3+ |
| InChIKey | MLEQRZXMDYRLPL-XVNBXDOJSA-N |
| XLogP | 3.09 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|