C29H40FNO3Si — CID 58614343
methyl (E)-3-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[2-(2-fluorophenyl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate (PubChem CID 58614343) has the molecular formula C29H40FNO3Si and a molecular weight of 497.73 g/mol. Its IUPAC name is methyl (E)-3-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[2-(2-fluorophenyl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[2-(2-fluorophenyl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 58614343 |
| Molecular Formula | C29H40FNO3Si |
| Molecular Weight | 497.73 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | methyl (E)-3-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl-[2-(2-fluorophenyl)ethyl]amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc2c(c1)CCC2N(CCO[Si](C)(C)C(C)(C)C)CCc1ccccc1F |
| InChI | InChI=1S/C29H40FNO3Si/c1-29(2,3)35(5,6)34-20-19-31(18-17-23-9-7-8-10-26(23)30)27-15-13-24-21-22(11-14-25(24)27)12-16-28(32)33-4/h7-12,14,16,21,27H,13,15,17-20H2,1-6H3/b16-12+ |
| InChIKey | QEMPGLLJQUMHKB-FOWTUZBSSA-N |
| XLogP | 6.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.73 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|