C28H28N2O2S — CID 58614482
methyl (E)-3-[1-[2-(1H-indol-3-yl)ethyl-(thiophen-2-ylmethyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate (PubChem CID 58614482) has the molecular formula C28H28N2O2S and a molecular weight of 456.61 g/mol. Its IUPAC name is methyl (E)-3-[1-[2-(1H-indol-3-yl)ethyl-(thiophen-2-ylmethyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[1-[2-(1H-indol-3-yl)ethyl-(thiophen-2-ylmethyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 58614482 |
| Molecular Formula | C28H28N2O2S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | methyl (E)-3-[1-[2-(1H-indol-3-yl)ethyl-(thiophen-2-ylmethyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc2c(c1)CCC2N(CCc1c[nH]c2ccccc12)Cc1cccs1 |
| InChI | InChI=1S/C28H28N2O2S/c1-32-28(31)13-9-20-8-11-25-21(17-20)10-12-27(25)30(19-23-5-4-16-33-23)15-14-22-18-29-26-7-3-2-6-24(22)26/h2-9,11,13,16-18,27,29H,10,12,14-15,19H2,1H3/b13-9+ |
| InChIKey | IGLFEEPGULFVJM-UKTHLTGXSA-N |
| XLogP | 6.15 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|