C31H30N4O2 — CID 58614532
(E)-N-hydroxy-3-[1-[2-(1H-indol-3-yl)ethyl-(1H-indol-4-ylmethyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide (PubChem CID 58614532) has the molecular formula C31H30N4O2 and a molecular weight of 490.61 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[1-[2-(1H-indol-3-yl)ethyl-(1H-indol-4-ylmethyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[1-[2-(1H-indol-3-yl)ethyl-(1H-indol-4-ylmethyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 58614532 |
| Molecular Formula | C31H30N4O2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | (E)-N-hydroxy-3-[1-[2-(1H-indol-3-yl)ethyl-(1H-indol-4-ylmethyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)CCC2N(CCc1c[nH]c2ccccc12)Cc1cccc2[nH]ccc12)NO |
| InChI | InChI=1S/C31H30N4O2/c36-31(34-37)13-9-21-8-11-27-22(18-21)10-12-30(27)35(20-24-4-3-7-28-26(24)14-16-32-28)17-15-23-19-33-29-6-2-1-5-25(23)29/h1-9,11,13-14,16,18-19,30,32-33,37H,10,12,15,17,20H2,(H,34,36)/b13-9+ |
| InChIKey | MCLVNSXPXYWJHE-UKTHLTGXSA-N |
| XLogP | 5.90 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|