C20H15ClF3N3O3S — CID 58614787
N-(4-chloro-3-pyridin-2-ylphenyl)-4-(2,2,2-trifluoroethylsulfamoyl)benzamide (PubChem CID 58614787) has the molecular formula C20H15ClF3N3O3S and a molecular weight of 469.87 g/mol. Its IUPAC name is N-(4-chloro-3-pyridin-2-ylphenyl)-4-(2,2,2-trifluoroethylsulfamoyl)benzamide.
| Compound Name | N-(4-chloro-3-pyridin-2-ylphenyl)-4-(2,2,2-trifluoroethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 58614787 |
| Molecular Formula | C20H15ClF3N3O3S |
| Molecular Weight | 469.87 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | N-(4-chloro-3-pyridin-2-ylphenyl)-4-(2,2,2-trifluoroethylsulfamoyl)benzamide |
| SMILES | O=C(Nc1ccc(Cl)c(-c2ccccn2)c1)c1ccc(S(=O)(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H15ClF3N3O3S/c21-17-9-6-14(11-16(17)18-3-1-2-10-25-18)27-19(28)13-4-7-15(8-5-13)31(29,30)26-12-20(22,23)24/h1-11,26H,12H2,(H,27,28) |
| InChIKey | ODCXDXRPWNNCOS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.87 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |