C20H14ClF4N3O2 — CID 58614935
N-[4-chloro-3-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]phenyl]-6-fluoro-2-methylpyridine-3-carboxamide (PubChem CID 58614935) has the molecular formula C20H14ClF4N3O2 and a molecular weight of 439.80 g/mol. Its IUPAC name is N-[4-chloro-3-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]phenyl]-6-fluoro-2-methylpyridine-3-carboxamide.
| Compound Name | N-[4-chloro-3-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]phenyl]-6-fluoro-2-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 58614935 |
| Molecular Formula | C20H14ClF4N3O2 |
| Molecular Weight | 439.80 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | N-[4-chloro-3-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]phenyl]-6-fluoro-2-methylpyridine-3-carboxamide |
| SMILES | Cc1nc(F)ccc1C(=O)Nc1ccc(Cl)c(-c2ccc(OCC(F)(F)F)cn2)c1 |
| InChI | InChI=1S/C20H14ClF4N3O2/c1-11-14(4-7-18(22)27-11)19(29)28-12-2-5-16(21)15(8-12)17-6-3-13(9-26-17)30-10-20(23,24)25/h2-9H,10H2,1H3,(H,28,29) |
| InChIKey | MFLCRMWQSKREJL-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.80 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|