C22H27NO4 — CID 58615120
(4R,4aS,7Z,12bS)-3-(cyclopropylmethyl)-7-(2-hydroxyethylidene)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol (PubChem CID 58615120) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is (4R,4aS,7Z,12bS)-3-(cyclopropylmethyl)-7-(2-hydroxyethylidene)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol.
| Compound Name | (4R,4aS,7Z,12bS)-3-(cyclopropylmethyl)-7-(2-hydroxyethylidene)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
|---|---|
| PubChem CID | 58615120 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (4R,4aS,7Z,12bS)-3-(cyclopropylmethyl)-7-(2-hydroxyethylidene)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
| SMILES | OC/C=C1/CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)C1O5 |
| InChI | InChI=1S/C22H27NO4/c24-10-6-14-5-7-22(26)17-11-15-3-4-16(25)19-18(15)21(22,20(14)27-19)8-9-23(17)12-13-1-2-13/h3-4,6,13,17,20,24-26H,1-2,5,7-12H2/b14-6-/t17-,20?,21+,22-/m1/s1 |
| InChIKey | AWIBYBBUQRJBLA-PKSYWGLVSA-N |
| XLogP | 1.88 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|