C29H62O7Si4 — CID 58615768
[3,4,5,6-tetrakis(trimethylsilyloxy)oxan-2-yl]methyl undec-10-enoate (PubChem CID 58615768) has the molecular formula C29H62O7Si4 and a molecular weight of 635.15 g/mol. Its IUPAC name is [3,4,5,6-tetrakis(trimethylsilyloxy)oxan-2-yl]methyl undec-10-enoate.
| Compound Name | [3,4,5,6-tetrakis(trimethylsilyloxy)oxan-2-yl]methyl undec-10-enoate |
|---|---|
| PubChem CID | 58615768 |
| Molecular Formula | C29H62O7Si4 |
| Molecular Weight | 635.15 g/mol |
| Exact Mass | 634.36 |
| IUPAC Name | [3,4,5,6-tetrakis(trimethylsilyloxy)oxan-2-yl]methyl undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)OCC1OC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C29H62O7Si4/c1-14-15-16-17-18-19-20-21-22-25(30)31-23-24-26(33-37(2,3)4)27(34-38(5,6)7)28(35-39(8,9)10)29(32-24)36-40(11,12)13/h14,24,26-29H,1,15-23H2,2-13H3 |
| InChIKey | WNJNFJPFSXTGAF-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.15 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|