About chlorocopper;2-propan-2-yl-6-[(3,4,5-trimethoxyphenyl)methylideneamino]phenol
chlorocopper;2-propan-2-yl-6-[(3,4,5-trimethoxyphenyl)methylideneamino]phenol (PubChem CID 58615876) has the molecular formula C19H23ClCuNO4
and a molecular weight of 428.40 g/mol. Its IUPAC name is chlorocopper;2-propan-2-yl-6-[(3,4,5-trimethoxyphenyl)methylideneamino]phenol.
Molecular Properties
| Compound Name | chlorocopper;2-propan-2-yl-6-[(3,4,5-trimethoxyphenyl)methylideneamino]phenol |
| PubChem CID | 58615876 |
| Molecular Formula | C19H23ClCuNO4 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | chlorocopper;2-propan-2-yl-6-[(3,4,5-trimethoxyphenyl)methylideneamino]phenol |
| SMILES | COc1cc(/C=N/c2cccc(C(C)C)c2O)cc(OC)c1OC.Cl[Cu] |
| InChI | InChI=1S/C19H23NO4.ClH.Cu/c1-12(2)14-7-6-8-15(18(14)21)20-11-13-9-16(22-3)19(24-5)17(10-13)23-4;;/h6-12,21H,1-5H3;1H;/q;;+1/p-1/b20-11+;; |
| InChIKey | KVALTVLVMCDTLO-XIIGDXBDSA-M |
| XLogP | 4.98 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze chlorocopper;2-propan-2-yl-6-[(3,4,5-trimethoxyphenyl)methylideneamino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorocopper;2-propan-2-yl-6-[(3,4,5-trimethoxyphenyl)methylideneamino]phenol?
The IUPAC name of chlorocopper;2-propan-2-yl-6-[(3,4,5-trimethoxyphenyl)methylideneamino]phenol (CID 58615876) is chlorocopper;2-propan-2-yl-6-[(3,4,5-trimethoxyphenyl)methylideneamino]phenol.
What is the SMILES notation for chlorocopper;2-propan-2-yl-6-[(3,4,5-trimethoxyphenyl)methylideneamino]phenol?
The canonical SMILES for chlorocopper;2-propan-2-yl-6-[(3,4,5-trimethoxyphenyl)methylideneamino]phenol is COc1cc(/C=N/c2cccc(C(C)C)c2O)cc(OC)c1OC.Cl[Cu].
What is the InChIKey of chlorocopper;2-propan-2-yl-6-[(3,4,5-trimethoxyphenyl)methylideneamino]phenol?
The InChIKey is KVALTVLVMCDTLO-XIIGDXBDSA-M. The full InChI is InChI=1S/C19H23NO4.ClH.Cu/c1-12(2)14-7-6-8-15(18(14)21)20-11-13-9-16(22-3)19(24-5)17(10-13)23-4;;/h6-12,21H,1-5H3;1H;/q;;+1/p-1/b20-11+;;.
What are the key properties of chlorocopper;2-propan-2-yl-6-[(3,4,5-trimethoxyphenyl)methylideneamino]phenol?
chlorocopper;2-propan-2-yl-6-[(3,4,5-trimethoxyphenyl)methylideneamino]phenol has a molecular weight of 428.40 g/mol, XLogP of 4.98, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for chlorocopper;2-propan-2-yl-6-[(3,4,5-trimethoxyphenyl)methylideneamino]phenol is sourced from PubChem (CID 58615876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).