C8H8F4N2O6 — CID 58616386
3-[2-[(2-carboxy-2,2-difluoroacetyl)amino]ethylamino]-2,2-difluoro-3-oxopropanoic acid (PubChem CID 58616386) has the molecular formula C8H8F4N2O6 and a molecular weight of 304.15 g/mol. Its IUPAC name is 3-[2-[(2-carboxy-2,2-difluoroacetyl)amino]ethylamino]-2,2-difluoro-3-oxopropanoic acid.
| Compound Name | 3-[2-[(2-carboxy-2,2-difluoroacetyl)amino]ethylamino]-2,2-difluoro-3-oxopropanoic acid |
|---|---|
| PubChem CID | 58616386 |
| Molecular Formula | C8H8F4N2O6 |
| Molecular Weight | 304.15 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 3-[2-[(2-carboxy-2,2-difluoroacetyl)amino]ethylamino]-2,2-difluoro-3-oxopropanoic acid |
| SMILES | O=C(O)C(F)(F)C(=O)NCCNC(=O)C(F)(F)C(=O)O |
| InChI | InChI=1S/C8H8F4N2O6/c9-7(10,5(17)18)3(15)13-1-2-14-4(16)8(11,12)6(19)20/h1-2H2,(H,13,15)(H,14,16)(H,17,18)(H,19,20) |
| InChIKey | SODKRYGPKYTLON-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.15 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|