C18H14F16O8S2 — CID 58616406
1,1,2,2,3,3,4,4-octafluoro-4-[2-[4-[2-[1,1,2,2,3,3,4,4-octafluoro-4-(trioxidanylsulfanyl)butoxy]ethyl]phenyl]ethoxy]butane-1-sulfonic acid (PubChem CID 58616406) has the molecular formula C18H14F16O8S2 and a molecular weight of 726.40 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoro-4-[2-[4-[2-[1,1,2,2,3,3,4,4-octafluoro-4-(trioxidanylsulfanyl)butoxy]ethyl]phenyl]ethoxy]butane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoro-4-[2-[4-[2-[1,1,2,2,3,3,4,4-octafluoro-4-(trioxidanylsulfanyl)butoxy]ethyl]phenyl]ethoxy]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 58616406 |
| Molecular Formula | C18H14F16O8S2 |
| Molecular Weight | 726.40 g/mol |
| Exact Mass | 725.99 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoro-4-[2-[4-[2-[1,1,2,2,3,3,4,4-octafluoro-4-(trioxidanylsulfanyl)butoxy]ethyl]phenyl]ethoxy]butane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OCCc1ccc(CCOC(F)(F)C(F)(F)C(F)(F)C(F)(F)SOOO)cc1 |
| InChI | InChI=1S/C18H14F16O8S2/c19-11(20,13(23,24)17(31,32)43-42-41-35)15(27,28)39-7-5-9-1-3-10(4-2-9)6-8-40-16(29,30)12(21,22)14(25,26)18(33,34)44(36,37)38/h1-4,35H,5-8H2,(H,36,37,38) |
| InChIKey | XYCHFKYZTJDMOD-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.40 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|