C8H10F8O6S4 — CID 58616417
1,1,2,2-tetrafluoro-2-[4-[1,1,2,2-tetrafluoro-2-(trioxidanylsulfanyl)ethyl]sulfanylbutylsulfanyl]ethanesulfonic acid (PubChem CID 58616417) has the molecular formula C8H10F8O6S4 and a molecular weight of 482.41 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[4-[1,1,2,2-tetrafluoro-2-(trioxidanylsulfanyl)ethyl]sulfanylbutylsulfanyl]ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-[4-[1,1,2,2-tetrafluoro-2-(trioxidanylsulfanyl)ethyl]sulfanylbutylsulfanyl]ethanesulfonic acid |
|---|---|
| PubChem CID | 58616417 |
| Molecular Formula | C8H10F8O6S4 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 481.92 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[4-[1,1,2,2-tetrafluoro-2-(trioxidanylsulfanyl)ethyl]sulfanylbutylsulfanyl]ethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)SCCCCSC(F)(F)C(F)(F)SOOO |
| InChI | InChI=1S/C8H10F8O6S4/c9-5(10,6(11,12)25-22-21-17)23-3-1-2-4-24-7(13,14)8(15,16)26(18,19)20/h17H,1-4H2,(H,18,19,20) |
| InChIKey | PSSZWTOCKHZQSS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|