C18H20F16O8S2-2 — CID 58616474
2-[4,7-diethyl-1,1,2,2,9,9,10,10-octafluoro-10-(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethoxy)decoxy]-1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 58616474) has the molecular formula C18H20F16O8S2-2 and a molecular weight of 732.45 g/mol. Its IUPAC name is 2-[4,7-diethyl-1,1,2,2,9,9,10,10-octafluoro-10-(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethoxy)decoxy]-1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | 2-[4,7-diethyl-1,1,2,2,9,9,10,10-octafluoro-10-(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethoxy)decoxy]-1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 58616474 |
| Molecular Formula | C18H20F16O8S2-2 |
| Molecular Weight | 732.45 g/mol |
| Exact Mass | 732.04 |
| IUPAC Name | 2-[4,7-diethyl-1,1,2,2,9,9,10,10-octafluoro-10-(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethoxy)decoxy]-1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | CCC(CCC(CC)CC(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(=O)(=O)[O-])CC(F)(F)C(F)(F)OC(F)(F)C(F)(F)SOO[O-] |
| InChI | InChI=1S/C18H22F16O8S2/c1-3-9(7-11(19,20)13(23,24)39-15(27,28)17(31,32)43-42-41-35)5-6-10(4-2)8-12(21,22)14(25,26)40-16(29,30)18(33,34)44(36,37)38/h9-10,35H,3-8H2,1-2H3,(H,36,37,38)/p-2 |
| InChIKey | LBZQROSCBPLIPJ-UHFFFAOYSA-L |
| XLogP | 6.88 |
| TPSA | 117.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.45 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|