C14H10F16O8S2-2 — CID 58616488
1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[4-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethoxy)ethyl]cyclohexyl]ethoxy]ethanesulfonate (PubChem CID 58616488) has the molecular formula C14H10F16O8S2-2 and a molecular weight of 674.33 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[4-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethoxy)ethyl]cyclohexyl]ethoxy]ethanesulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[4-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethoxy)ethyl]cyclohexyl]ethoxy]ethanesulfonate |
|---|---|
| PubChem CID | 58616488 |
| Molecular Formula | C14H10F16O8S2-2 |
| Molecular Weight | 674.33 g/mol |
| Exact Mass | 673.96 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[4-[1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethoxy)ethyl]cyclohexyl]ethoxy]ethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)OC(F)(F)C(F)(F)C1CCC(C(F)(F)C(F)(F)OC(F)(F)C(F)(F)SOO[O-])CC1 |
| InChI | InChI=1S/C14H12F16O8S2/c15-7(16,9(19,20)35-11(23,24)13(27,28)39-38-37-31)5-1-3-6(4-2-5)8(17,18)10(21,22)36-12(25,26)14(29,30)40(32,33)34/h5-6,31H,1-4H2,(H,32,33,34)/p-2 |
| InChIKey | QAHIRYAFAMAGCQ-UHFFFAOYSA-L |
| XLogP | 5.07 |
| TPSA | 117.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.33 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|