C37H49N5O4 — CID 58616624
[2-tert-butyl-4-methyl-6-(2-methylpropyl)cyclohexyl] 5-[bis(prop-2-enyl)carbamoyloxy]-2-(2,5-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 58616624) has the molecular formula C37H49N5O4 and a molecular weight of 627.83 g/mol. Its IUPAC name is [2-tert-butyl-4-methyl-6-(2-methylpropyl)cyclohexyl] 5-[bis(prop-2-enyl)carbamoyloxy]-2-(2,5-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | [2-tert-butyl-4-methyl-6-(2-methylpropyl)cyclohexyl] 5-[bis(prop-2-enyl)carbamoyloxy]-2-(2,5-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 58616624 |
| Molecular Formula | C37H49N5O4 |
| Molecular Weight | 627.83 g/mol |
| Exact Mass | 627.38 |
| IUPAC Name | [2-tert-butyl-4-methyl-6-(2-methylpropyl)cyclohexyl] 5-[bis(prop-2-enyl)carbamoyloxy]-2-(2,5-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(CC(C)C)CC(C)CC2C(C)(C)C)c2nc(-c3cc(C)ccc3C)[nH]n2c1OC(=O)N(CC=C)CC=C |
| InChI | InChI=1S/C37H49N5O4/c1-12-16-41(17-13-2)36(44)46-34-30(38-11)29(33-39-32(40-42(33)34)27-20-23(5)14-15-25(27)7)35(43)45-31-26(18-22(3)4)19-24(6)21-28(31)37(8,9)10/h12-15,20,22,24,26,28,31H,1-2,16-19,21H2,3-10H3,(H,39,40) |
| InChIKey | UQFQBLIRRUCBNK-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.83 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|