C31H31N5O4 — CID 58616648
[7-(2,6-dimethylcyclohexyl)oxycarbonyl-6-isocyano-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] 2,3-dihydroindole-1-carboxylate (PubChem CID 58616648) has the molecular formula C31H31N5O4 and a molecular weight of 537.62 g/mol. Its IUPAC name is [7-(2,6-dimethylcyclohexyl)oxycarbonyl-6-isocyano-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] 2,3-dihydroindole-1-carboxylate.
| Compound Name | [7-(2,6-dimethylcyclohexyl)oxycarbonyl-6-isocyano-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] 2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 58616648 |
| Molecular Formula | C31H31N5O4 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | [7-(2,6-dimethylcyclohexyl)oxycarbonyl-6-isocyano-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] 2,3-dihydroindole-1-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C)CCCC2C)c2nc(-c3ccc(C)cc3)[nH]n2c1OC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C31H31N5O4/c1-18-12-14-22(15-13-18)27-33-28-24(30(37)39-26-19(2)8-7-9-20(26)3)25(32-4)29(36(28)34-27)40-31(38)35-17-16-21-10-5-6-11-23(21)35/h5-6,10-15,19-20,26H,7-9,16-17H2,1-3H3,(H,33,34) |
| InChIKey | XWVKOMGVFPPMJH-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|