C10H17N3O — CID 58616691
(8Z)-3-butan-2-yl-5,6-dihydro-4H-1,3,6-triazonin-7-one (PubChem CID 58616691) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is (8Z)-3-butan-2-yl-5,6-dihydro-4H-1,3,6-triazonin-7-one.
| Compound Name | (8Z)-3-butan-2-yl-5,6-dihydro-4H-1,3,6-triazonin-7-one |
|---|---|
| PubChem CID | 58616691 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | (8Z)-3-butan-2-yl-5,6-dihydro-4H-1,3,6-triazonin-7-one |
| SMILES | CCC(C)N1/C=N\C=C/C(=O)NCC1 |
| InChI | InChI=1S/C10H17N3O/c1-3-9(2)13-7-6-12-10(14)4-5-11-8-13/h4-5,8-9H,3,6-7H2,1-2H3,(H,12,14)/b5-4-,11-8- |
| InChIKey | QDFOMMZZUBKVAW-YMVJEYMASA-N |
| XLogP | 0.76 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |