C13H14F3NO2 — CID 58617146
3-[(3R,4S)-3-(trifluoromethyl)piperidin-4-yl]benzoic acid (PubChem CID 58617146) has the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. Its IUPAC name is 3-[(3R,4S)-3-(trifluoromethyl)piperidin-4-yl]benzoic acid.
| Compound Name | 3-[(3R,4S)-3-(trifluoromethyl)piperidin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 58617146 |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 3-[(3R,4S)-3-(trifluoromethyl)piperidin-4-yl]benzoic acid |
| SMILES | O=C(O)c1cccc([C@H]2CCNC[C@@H]2C(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F3NO2/c14-13(15,16)11-7-17-5-4-10(11)8-2-1-3-9(6-8)12(18)19/h1-3,6,10-11,17H,4-5,7H2,(H,18,19)/t10-,11+/m1/s1 |
| InChIKey | PIJMRTQIUNACRO-MNOVXSKESA-N |
| XLogP | 2.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |