C23H31F3N2O5S — CID 58617189
[(1S)-1-propan-2-yl-3-[4-(trioxidanylsulfanyl)piperidin-1-yl]cyclopentyl]-[6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazin-3-yl]methanone (PubChem CID 58617189) has the molecular formula C23H31F3N2O5S and a molecular weight of 504.57 g/mol. Its IUPAC name is [(1S)-1-propan-2-yl-3-[4-(trioxidanylsulfanyl)piperidin-1-yl]cyclopentyl]-[6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazin-3-yl]methanone.
| Compound Name | [(1S)-1-propan-2-yl-3-[4-(trioxidanylsulfanyl)piperidin-1-yl]cyclopentyl]-[6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazin-3-yl]methanone |
|---|---|
| PubChem CID | 58617189 |
| Molecular Formula | C23H31F3N2O5S |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | [(1S)-1-propan-2-yl-3-[4-(trioxidanylsulfanyl)piperidin-1-yl]cyclopentyl]-[6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazin-3-yl]methanone |
| SMILES | CC(C)[C@]1(C(=O)N2COc3ccc(C(F)(F)F)cc3C2)CCC(N2CCC(SOOO)CC2)C1 |
| InChI | InChI=1S/C23H31F3N2O5S/c1-15(2)22(8-5-18(12-22)27-9-6-19(7-10-27)34-33-32-30)21(29)28-13-16-11-17(23(24,25)26)3-4-20(16)31-14-28/h3-4,11,15,18-19,30H,5-10,12-14H2,1-2H3/t18?,22-/m0/s1 |
| InChIKey | FJHYAWJISLTGDW-YSYXNDDBSA-N |
| XLogP | 5.11 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|