C12H19N — CID 58618049
N-propan-2-yl-4,5,6,7-tetrahydro-1H-inden-2-amine (PubChem CID 58618049) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is N-propan-2-yl-4,5,6,7-tetrahydro-1H-inden-2-amine.
| Compound Name | N-propan-2-yl-4,5,6,7-tetrahydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 58618049 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | N-propan-2-yl-4,5,6,7-tetrahydro-1H-inden-2-amine |
| SMILES | CC(C)NC1=CC2=C(CCCC2)C1 |
| InChI | InChI=1S/C12H19N/c1-9(2)13-12-7-10-5-3-4-6-11(10)8-12/h7,9,13H,3-6,8H2,1-2H3 |
| InChIKey | LGONIFODKLDYDC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |