About 5-methanidyl-3-methyl-4,5-dihydro-1,2-oxazole;yttrium
5-methanidyl-3-methyl-4,5-dihydro-1,2-oxazole;yttrium (PubChem CID 58618695) has the molecular formula C5H8NOY-
and a molecular weight of 187.03 g/mol. Its IUPAC name is 5-methanidyl-3-methyl-4,5-dihydro-1,2-oxazole;yttrium.
Molecular Properties
| Compound Name | 5-methanidyl-3-methyl-4,5-dihydro-1,2-oxazole;yttrium |
| PubChem CID | 58618695 |
| Molecular Formula | C5H8NOY- |
| Molecular Weight | 187.03 g/mol |
| Exact Mass | 186.97 |
| IUPAC Name | 5-methanidyl-3-methyl-4,5-dihydro-1,2-oxazole;yttrium |
| SMILES | [CH2-]C1CC(C)=NO1.[Y] |
| InChI | InChI=1S/C5H8NO.Y/c1-4-3-5(2)7-6-4;/h5H,2-3H2,1H3;/q-1; |
| InChIKey | NBZMQWHQPQRIEW-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.03 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-methanidyl-3-methyl-4,5-dihydro-1,2-oxazole;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methanidyl-3-methyl-4,5-dihydro-1,2-oxazole;yttrium?
The IUPAC name of 5-methanidyl-3-methyl-4,5-dihydro-1,2-oxazole;yttrium (CID 58618695) is 5-methanidyl-3-methyl-4,5-dihydro-1,2-oxazole;yttrium.
What is the SMILES notation for 5-methanidyl-3-methyl-4,5-dihydro-1,2-oxazole;yttrium?
The canonical SMILES for 5-methanidyl-3-methyl-4,5-dihydro-1,2-oxazole;yttrium is [CH2-]C1CC(C)=NO1.[Y].
What is the InChIKey of 5-methanidyl-3-methyl-4,5-dihydro-1,2-oxazole;yttrium?
The InChIKey is NBZMQWHQPQRIEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8NO.Y/c1-4-3-5(2)7-6-4;/h5H,2-3H2,1H3;/q-1;.
What are the key properties of 5-methanidyl-3-methyl-4,5-dihydro-1,2-oxazole;yttrium?
5-methanidyl-3-methyl-4,5-dihydro-1,2-oxazole;yttrium has a molecular weight of 187.03 g/mol, XLogP of 0.98, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methanidyl-3-methyl-4,5-dihydro-1,2-oxazole;yttrium is sourced from PubChem (CID 58618695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).