C38H66O6Si — CID 58619135
[(4E)-10-[tert-butyl(dimethyl)silyl]oxy-3,7,7-trimethyl-2-[(2E,4E)-6-methyl-7-[3-(3-methylpentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]-12-oxo-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 58619135) has the molecular formula C38H66O6Si and a molecular weight of 647.03 g/mol. Its IUPAC name is [(4E)-10-[tert-butyl(dimethyl)silyl]oxy-3,7,7-trimethyl-2-[(2E,4E)-6-methyl-7-[3-(3-methylpentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]-12-oxo-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(4E)-10-[tert-butyl(dimethyl)silyl]oxy-3,7,7-trimethyl-2-[(2E,4E)-6-methyl-7-[3-(3-methylpentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 58619135 |
| Molecular Formula | C38H66O6Si |
| Molecular Weight | 647.03 g/mol |
| Exact Mass | 646.46 |
| IUPAC Name | [(4E)-10-[tert-butyl(dimethyl)silyl]oxy-3,7,7-trimethyl-2-[(2E,4E)-6-methyl-7-[3-(3-methylpentan-2-yl)oxiran-2-yl]hepta-2,4-dien-2-yl]-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | CCC(C)C(C)C1OC1CC(C)/C=C/C=C(\C)C1OC(=O)CC(O[Si](C)(C)C(C)(C)C)CCC(C)(C)C(OC(C)=O)/C=C/C1C |
| InChI | InChI=1S/C38H66O6Si/c1-15-26(3)29(6)36-32(42-36)23-25(2)17-16-18-27(4)35-28(5)19-20-33(41-30(7)39)38(11,12)22-21-31(24-34(40)43-35)44-45(13,14)37(8,9)10/h16-20,25-26,28-29,31-33,35-36H,15,21-24H2,1-14H3/b17-16+,20-19+,27-18+ |
| InChIKey | XHLJYTKEGWMFJO-UBDDYVSRSA-N |
| XLogP | 9.60 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.03 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|