C25H40O6 — CID 58619145
[(4E)-10-hydroxy-2-[(2E,4E)-7-hydroxy-6-methylnona-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 58619145) has the molecular formula C25H40O6 and a molecular weight of 436.59 g/mol. Its IUPAC name is [(4E)-10-hydroxy-2-[(2E,4E)-7-hydroxy-6-methylnona-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(4E)-10-hydroxy-2-[(2E,4E)-7-hydroxy-6-methylnona-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 58619145 |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | [(4E)-10-hydroxy-2-[(2E,4E)-7-hydroxy-6-methylnona-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | CCC(O)C(C)/C=C/C=C(\C)C1OC(=O)CC(O)CCC(C)C(OC(C)=O)/C=C/C1C |
| InChI | InChI=1S/C25H40O6/c1-7-22(28)16(2)9-8-10-18(4)25-19(5)12-14-23(30-20(6)26)17(3)11-13-21(27)15-24(29)31-25/h8-10,12,14,16-17,19,21-23,25,27-28H,7,11,13,15H2,1-6H3/b9-8+,14-12+,18-10+ |
| InChIKey | CUCKCWGKCPXBEA-JJDLPXRFSA-N |
| XLogP | 4.11 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|