C15H26O5 — CID 58619938
(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-6-[[(E)-4-methylpent-2-enoxy]methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (PubChem CID 58619938) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is (3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-6-[[(E)-4-methylpent-2-enoxy]methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole.
| Compound Name | (3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-6-[[(E)-4-methylpent-2-enoxy]methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 58619938 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-6-[[(E)-4-methylpent-2-enoxy]methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| SMILES | CO[C@@H]1O[C@H](COC/C=C/C(C)C)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C15H26O5/c1-10(2)7-6-8-17-9-11-12-13(14(16-5)18-11)20-15(3,4)19-12/h6-7,10-14H,8-9H2,1-5H3/b7-6+/t11-,12-,13-,14-/m1/s1 |
| InChIKey | HFBMPUHJIZYDID-VZUGPRAESA-N |
| XLogP | 2.11 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|