C12H17N3O3 — CID 58619943
(2Z)-N-[(E)-4,4-dimethylpent-2-enyl]-2-(2,5-dioxoimidazolidin-4-ylidene)acetamide (PubChem CID 58619943) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is (2Z)-N-[(E)-4,4-dimethylpent-2-enyl]-2-(2,5-dioxoimidazolidin-4-ylidene)acetamide.
| Compound Name | (2Z)-N-[(E)-4,4-dimethylpent-2-enyl]-2-(2,5-dioxoimidazolidin-4-ylidene)acetamide |
|---|---|
| PubChem CID | 58619943 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (2Z)-N-[(E)-4,4-dimethylpent-2-enyl]-2-(2,5-dioxoimidazolidin-4-ylidene)acetamide |
| SMILES | CC(C)(C)/C=C/CNC(=O)/C=C1\NC(=O)NC1=O |
| InChI | InChI=1S/C12H17N3O3/c1-12(2,3)5-4-6-13-9(16)7-8-10(17)15-11(18)14-8/h4-5,7H,6H2,1-3H3,(H,13,16)(H2,14,15,17,18)/b5-4+,8-7- |
| InChIKey | RSWCVHQLEDNRDU-HTKRNXBHSA-N |
| XLogP | 0.43 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|