C33H41F2N5O — CID 58620047
(3S)-N-[2-[2-(2,4-difluorophenyl)ethyl]-1-oxoisoquinolin-6-yl]-3-methyl-N'-[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide (PubChem CID 58620047) has the molecular formula C33H41F2N5O and a molecular weight of 561.72 g/mol. Its IUPAC name is (3S)-N-[2-[2-(2,4-difluorophenyl)ethyl]-1-oxoisoquinolin-6-yl]-3-methyl-N'-[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide.
| Compound Name | (3S)-N-[2-[2-(2,4-difluorophenyl)ethyl]-1-oxoisoquinolin-6-yl]-3-methyl-N'-[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 58620047 |
| Molecular Formula | C33H41F2N5O |
| Molecular Weight | 561.72 g/mol |
| Exact Mass | 561.33 |
| IUPAC Name | (3S)-N-[2-[2-(2,4-difluorophenyl)ethyl]-1-oxoisoquinolin-6-yl]-3-methyl-N'-[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
| SMILES | C[C@@H]1[C@@H](/N=C(/Nc2ccc3c(=O)n(CCc4ccc(F)cc4F)ccc3c2)N2CCN[C@@H](C)C2)C[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C33H41F2N5O/c1-20-19-40(14-11-36-20)32(38-30-17-24-16-28(21(30)2)33(24,3)4)37-26-7-8-27-23(15-26)10-13-39(31(27)41)12-9-22-5-6-25(34)18-29(22)35/h5-8,10,13,15,18,20-21,24,28,30,36H,9,11-12,14,16-17,19H2,1-4H3,(H,37,38)/t20-,21-,24-,28+,30-/m0/s1 |
| InChIKey | VGKJILBIUSTZMB-YOZIIKJPSA-N |
| XLogP | 5.65 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.72 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|