C33H43FN6O2 — CID 58620083
(3S)-N-[3-[2-(4-fluorophenyl)ethyl]-1-methyl-2,4-dioxoquinazolin-7-yl]-3-methyl-N'-[(1R,2S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide (PubChem CID 58620083) has the molecular formula C33H43FN6O2 and a molecular weight of 574.75 g/mol. Its IUPAC name is (3S)-N-[3-[2-(4-fluorophenyl)ethyl]-1-methyl-2,4-dioxoquinazolin-7-yl]-3-methyl-N'-[(1R,2S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide.
| Compound Name | (3S)-N-[3-[2-(4-fluorophenyl)ethyl]-1-methyl-2,4-dioxoquinazolin-7-yl]-3-methyl-N'-[(1R,2S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 58620083 |
| Molecular Formula | C33H43FN6O2 |
| Molecular Weight | 574.75 g/mol |
| Exact Mass | 574.34 |
| IUPAC Name | (3S)-N-[3-[2-(4-fluorophenyl)ethyl]-1-methyl-2,4-dioxoquinazolin-7-yl]-3-methyl-N'-[(1R,2S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
| SMILES | C[C@@H]1C(/N=C(/Nc2ccc3c(=O)n(CCc4ccc(F)cc4)c(=O)n(C)c3c2)N2CCN[C@@H](C)C2)C[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C33H43FN6O2/c1-20-19-39(15-13-35-20)31(37-28-17-23-16-27(21(28)2)33(23,3)4)36-25-10-11-26-29(18-25)38(5)32(42)40(30(26)41)14-12-22-6-8-24(34)9-7-22/h6-11,18,20-21,23,27-28,35H,12-17,19H2,1-5H3,(H,36,37)/t20-,21-,23-,27+,28?/m0/s1 |
| InChIKey | VXVXMDQCCWXOFO-FUQHYGOESA-N |
| XLogP | 4.21 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.75 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|