About CID 58620221
CID 58620221 (PubChem CID 58620221) has the molecular formula C10H8O
and a molecular weight of 144.17 g/mol.
Molecular Properties
| Compound Name | CID 58620221 |
| PubChem CID | 58620221 |
| Molecular Formula | C10H8O |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | — |
| SMILES | [CH]C1C(=O)Cc2ccccc21 |
| InChI | InChI=1S/C10H8O/c1-7-9-5-3-2-4-8(9)6-10(7)11/h1-5,7H,6H2 |
| InChIKey | FYWQFNIZHIAILG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 58620221 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58620221?
The IUPAC name of CID 58620221 (CID 58620221) is not available.
What is the SMILES notation for CID 58620221?
The canonical SMILES for CID 58620221 is [CH]C1C(=O)Cc2ccccc21.
What is the InChIKey of CID 58620221?
The InChIKey is FYWQFNIZHIAILG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O/c1-7-9-5-3-2-4-8(9)6-10(7)11/h1-5,7H,6H2.
What are the key properties of CID 58620221?
CID 58620221 has a molecular weight of 144.17 g/mol, XLogP of 1.61, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58620221 is sourced from PubChem (CID 58620221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).