C38H42B2N2O4 — CID 58620849
9-methyl-3-[9-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-3-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole (PubChem CID 58620849) has the molecular formula C38H42B2N2O4 and a molecular weight of 612.39 g/mol. Its IUPAC name is 9-methyl-3-[9-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-3-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole.
| Compound Name | 9-methyl-3-[9-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-3-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
|---|---|
| PubChem CID | 58620849 |
| Molecular Formula | C38H42B2N2O4 |
| Molecular Weight | 612.39 g/mol |
| Exact Mass | 612.33 |
| IUPAC Name | 9-methyl-3-[9-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-3-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
| SMILES | Cn1c2ccc(B3OC(C)(C)C(C)(C)O3)cc2c2cc(-c3ccc4c(c3)c3cc(B5OC(C)(C)C(C)(C)O5)ccc3n4C)ccc21 |
| InChI | InChI=1S/C38H42B2N2O4/c1-35(2)36(3,4)44-39(43-35)25-13-17-33-29(21-25)27-19-23(11-15-31(27)41(33)9)24-12-16-32-28(20-24)30-22-26(14-18-34(30)42(32)10)40-45-37(5,6)38(7,8)46-40/h11-22H,1-10H3 |
| InChIKey | QKSPTBGRWGKMOB-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 46.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.39 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|