About CID 58620882
CID 58620882 (PubChem CID 58620882) has the molecular formula C31H18F7N3OPt
and a molecular weight of 776.57 g/mol.
Molecular Properties
| Compound Name | CID 58620882 |
| PubChem CID | 58620882 |
| Molecular Formula | C31H18F7N3OPt |
| Molecular Weight | 776.57 g/mol |
| Exact Mass | 776.10 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]c1c(F)c2[c-]c(c1F)C(C)(C)c1cccc(n1)C(C)(C)c1cccc(n1)-c1[c-]c(c(F)c(C(F)(F)F)c1F)C2=O.[Pt+2] |
| InChI | InChI=1S/C31H18F7N3O.Pt/c1-29(2)17-13-16(25(34)27(39-5)26(17)35)28(42)15-12-14(23(32)22(24(15)33)31(36,37)38)18-8-6-9-20(40-18)30(3,4)21-11-7-10-19(29)41-21;/h6-11H,1-4H3;/q-2;+2 |
| InChIKey | HGUAVWSOSKQRHR-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 47.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 776.57 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 58620882 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58620882?
The IUPAC name of CID 58620882 (CID 58620882) is not available.
What is the SMILES notation for CID 58620882?
The canonical SMILES for CID 58620882 is [C-]#[N+]c1c(F)c2[c-]c(c1F)C(C)(C)c1cccc(n1)C(C)(C)c1cccc(n1)-c1[c-]c(c(F)c(C(F)(F)F)c1F)C2=O.[Pt+2].
What is the InChIKey of CID 58620882?
The InChIKey is HGUAVWSOSKQRHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H18F7N3O.Pt/c1-29(2)17-13-16(25(34)27(39-5)26(17)35)28(42)15-12-14(23(32)22(24(15)33)31(36,37)38)18-8-6-9-20(40-18)30(3,4)21-11-7-10-19(29)41-21;/h6-11H,1-4H3;/q-2;+2.
What are the key properties of CID 58620882?
CID 58620882 has a molecular weight of 776.57 g/mol, XLogP of 8.06, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58620882 is sourced from PubChem (CID 58620882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).