C32H22BrF5N2 — CID 58620921
2-(3-bromo-2,4-difluorophenyl)-6-[[6-(2,3,4-trifluorophenyl)-2-pyridinyl]-(2,4,6-trimethylphenyl)methyl]pyridine (PubChem CID 58620921) has the molecular formula C32H22BrF5N2 and a molecular weight of 609.44 g/mol. Its IUPAC name is 2-(3-bromo-2,4-difluorophenyl)-6-[[6-(2,3,4-trifluorophenyl)-2-pyridinyl]-(2,4,6-trimethylphenyl)methyl]pyridine.
| Compound Name | 2-(3-bromo-2,4-difluorophenyl)-6-[[6-(2,3,4-trifluorophenyl)-2-pyridinyl]-(2,4,6-trimethylphenyl)methyl]pyridine |
|---|---|
| PubChem CID | 58620921 |
| Molecular Formula | C32H22BrF5N2 |
| Molecular Weight | 609.44 g/mol |
| Exact Mass | 608.09 |
| IUPAC Name | 2-(3-bromo-2,4-difluorophenyl)-6-[[6-(2,3,4-trifluorophenyl)-2-pyridinyl]-(2,4,6-trimethylphenyl)methyl]pyridine |
| SMILES | Cc1cc(C)c(C(c2cccc(-c3ccc(F)c(F)c3F)n2)c2cccc(-c3ccc(F)c(Br)c3F)n2)c(C)c1 |
| InChI | InChI=1S/C32H22BrF5N2/c1-16-14-17(2)27(18(3)15-16)28(25-8-4-6-23(39-25)19-10-12-21(34)29(33)30(19)36)26-9-5-7-24(40-26)20-11-13-22(35)32(38)31(20)37/h4-15,28H,1-3H3 |
| InChIKey | MFLITZRRTVICLM-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.44 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|