C31H25F3IrN5O2- — CID 58620987
iridium;6-[5-phenyl-1-pyridin-2-yl-1-[6-[4-(trifluoromethyl)pyrazol-1-yl]-2-pyridinyl]pentyl]pyridine-2-carboxylic acid (PubChem CID 58620987) has the molecular formula C31H25F3IrN5O2- and a molecular weight of 748.79 g/mol. Its IUPAC name is iridium;6-[5-phenyl-1-pyridin-2-yl-1-[6-[4-(trifluoromethyl)pyrazol-1-yl]-2-pyridinyl]pentyl]pyridine-2-carboxylic acid.
| Compound Name | iridium;6-[5-phenyl-1-pyridin-2-yl-1-[6-[4-(trifluoromethyl)pyrazol-1-yl]-2-pyridinyl]pentyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 58620987 |
| Molecular Formula | C31H25F3IrN5O2- |
| Molecular Weight | 748.79 g/mol |
| Exact Mass | 749.16 |
| IUPAC Name | iridium;6-[5-phenyl-1-pyridin-2-yl-1-[6-[4-(trifluoromethyl)pyrazol-1-yl]-2-pyridinyl]pentyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(C(CCCCc2[c-]cccc2)(c2ccccn2)c2cccc(-n3cc(C(F)(F)F)cn3)n2)n1.[Ir] |
| InChI | InChI=1S/C31H25F3N5O2.Ir/c32-31(33,34)23-20-36-39(21-23)28-17-9-16-27(38-28)30(25-14-5-7-19-35-25,26-15-8-13-24(37-26)29(40)41)18-6-4-12-22-10-2-1-3-11-22;/h1-3,5,7-10,13-17,19-21H,4,6,12,18H2,(H,40,41);/q-1; |
| InChIKey | AOJGIAOMSOFNNA-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.79 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|