About CID 58621030
CID 58621030 (PubChem CID 58621030) has the molecular formula C54H54N4O4Ru
and a molecular weight of 924.12 g/mol.
Molecular Properties
| Compound Name | CID 58621030 |
| PubChem CID | 58621030 |
| Molecular Formula | C54H54N4O4Ru |
| Molecular Weight | 924.12 g/mol |
| Exact Mass | 924.32 |
| IUPAC Name | — |
| SMILES | [Ru+2].[c-]1cc2ccc1-c1cccc(n1)-c1[c-]cc(cc1)OCCCCCCCCOc1c(-c3ccccn3)nc(-c3ccccn3)c(c1-c1ccccc1)OCCCCCCCCO2 |
| InChI | InChI=1S/C54H54N4O4.Ru/c1-3-7-18-39-61-53-50(43-21-10-9-11-22-43)54(52(49-24-13-15-36-56-49)58-51(53)48-23-12-14-35-55-48)62-40-19-8-4-2-6-17-38-60-45-33-29-42(30-34-45)47-26-20-25-46(57-47)41-27-31-44(32-28-41)59-37-16-5-1;/h9-15,20-27,29,31-36H,1-8,16-19,37-40H2;/q-2;+2 |
| InChIKey | WNQPXQHJRFGOLT-UHFFFAOYSA-N |
| XLogP | 13.11 |
| TPSA | 88.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 63 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 924.12 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 58621030 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58621030?
The IUPAC name of CID 58621030 (CID 58621030) is not available.
What is the SMILES notation for CID 58621030?
The canonical SMILES for CID 58621030 is [Ru+2].[c-]1cc2ccc1-c1cccc(n1)-c1[c-]cc(cc1)OCCCCCCCCOc1c(-c3ccccn3)nc(-c3ccccn3)c(c1-c1ccccc1)OCCCCCCCCO2.
What is the InChIKey of CID 58621030?
The InChIKey is WNQPXQHJRFGOLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C54H54N4O4.Ru/c1-3-7-18-39-61-53-50(43-21-10-9-11-22-43)54(52(49-24-13-15-36-56-49)58-51(53)48-23-12-14-35-55-48)62-40-19-8-4-2-6-17-38-60-45-33-29-42(30-34-45)47-26-20-25-46(57-47)41-27-31-44(32-28-41)59-37-16-5-1;/h9-15,20-27,29,31-36H,1-8,16-19,37-40H2;/q-2;+2.
What are the key properties of CID 58621030?
CID 58621030 has a molecular weight of 924.12 g/mol, XLogP of 13.11, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58621030 is sourced from PubChem (CID 58621030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).