About iridium;1-phenyl-3-propyl-1,2,4-triazole
iridium;1-phenyl-3-propyl-1,2,4-triazole (PubChem CID 58621045) has the molecular formula C11H12IrN3-
and a molecular weight of 378.46 g/mol. Its IUPAC name is iridium;1-phenyl-3-propyl-1,2,4-triazole.
Molecular Properties
| Compound Name | iridium;1-phenyl-3-propyl-1,2,4-triazole |
| PubChem CID | 58621045 |
| Molecular Formula | C11H12IrN3- |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | iridium;1-phenyl-3-propyl-1,2,4-triazole |
| SMILES | CCCc1ncn(-c2[c-]cccc2)n1.[Ir] |
| InChI | InChI=1S/C11H12N3.Ir/c1-2-6-11-12-9-14(13-11)10-7-4-3-5-8-10;/h3-5,7,9H,2,6H2,1H3;/q-1; |
| InChIKey | FXYSLJDILRUFEP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;1-phenyl-3-propyl-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;1-phenyl-3-propyl-1,2,4-triazole?
The IUPAC name of iridium;1-phenyl-3-propyl-1,2,4-triazole (CID 58621045) is iridium;1-phenyl-3-propyl-1,2,4-triazole.
What is the SMILES notation for iridium;1-phenyl-3-propyl-1,2,4-triazole?
The canonical SMILES for iridium;1-phenyl-3-propyl-1,2,4-triazole is CCCc1ncn(-c2[c-]cccc2)n1.[Ir].
What is the InChIKey of iridium;1-phenyl-3-propyl-1,2,4-triazole?
The InChIKey is FXYSLJDILRUFEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N3.Ir/c1-2-6-11-12-9-14(13-11)10-7-4-3-5-8-10;/h3-5,7,9H,2,6H2,1H3;/q-1;.
What are the key properties of iridium;1-phenyl-3-propyl-1,2,4-triazole?
iridium;1-phenyl-3-propyl-1,2,4-triazole has a molecular weight of 378.46 g/mol, XLogP of 2.02, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;1-phenyl-3-propyl-1,2,4-triazole is sourced from PubChem (CID 58621045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).