C49H53N3O4 — CID 58621049
12-heptyl-15,17-dipyridin-2-yl-11,13,19,28-tetraoxa-37-azapentacyclo[27.2.2.27,10.12,6.114,18]heptatriaconta-1(31),2(37),3,5,7(36),8,10(35),14,16,18(34),29,32-dodecaene (PubChem CID 58621049) has the molecular formula C49H53N3O4 and a molecular weight of 747.98 g/mol. Its IUPAC name is 12-heptyl-15,17-dipyridin-2-yl-11,13,19,28-tetraoxa-37-azapentacyclo[27.2.2.27,10.12,6.114,18]heptatriaconta-1(31),2(37),3,5,7(36),8,10(35),14,16,18(34),29,32-dodecaene.
| Compound Name | 12-heptyl-15,17-dipyridin-2-yl-11,13,19,28-tetraoxa-37-azapentacyclo[27.2.2.27,10.12,6.114,18]heptatriaconta-1(31),2(37),3,5,7(36),8,10(35),14,16,18(34),29,32-dodecaene |
|---|---|
| PubChem CID | 58621049 |
| Molecular Formula | C49H53N3O4 |
| Molecular Weight | 747.98 g/mol |
| Exact Mass | 747.40 |
| IUPAC Name | 12-heptyl-15,17-dipyridin-2-yl-11,13,19,28-tetraoxa-37-azapentacyclo[27.2.2.27,10.12,6.114,18]heptatriaconta-1(31),2(37),3,5,7(36),8,10(35),14,16,18(34),29,32-dodecaene |
| SMILES | CCCCCCCC1Oc2ccc(cc2)-c2cccc(n2)-c2ccc(cc2)OCCCCCCCCOc2cc(c(-c3ccccn3)cc2-c2ccccn2)O1 |
| InChI | InChI=1S/C49H53N3O4/c1-2-3-4-7-10-22-49-55-40-29-25-38(26-30-40)44-21-17-20-43(52-44)37-23-27-39(28-24-37)53-33-15-8-5-6-9-16-34-54-47-36-48(56-49)42(46-19-12-14-32-51-46)35-41(47)45-18-11-13-31-50-45/h11-14,17-21,23-32,35-36,49H,2-10,15-16,22,33-34H2,1H3 |
| InChIKey | BCTGYQFETSNYNM-UHFFFAOYSA-N |
| XLogP | 12.80 |
| TPSA | 75.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.98 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|